C23H29N3O2 — CID 58664234
[(8aS)-6-(4-methoxy-2,3-dimethylphenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(6-methyl-3-pyridinyl)methanone (PubChem CID 58664234) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is [(8aS)-6-(4-methoxy-2,3-dimethylphenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(6-methyl-3-pyridinyl)methanone.
| Compound Name | [(8aS)-6-(4-methoxy-2,3-dimethylphenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(6-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 58664234 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | [(8aS)-6-(4-methoxy-2,3-dimethylphenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(6-methyl-3-pyridinyl)methanone |
| SMILES | COc1ccc(C2CC[C@H]3CN(C(=O)c4ccc(C)nc4)CCN23)c(C)c1C |
| InChI | InChI=1S/C23H29N3O2/c1-15-5-6-18(13-24-15)23(27)25-11-12-26-19(14-25)7-9-21(26)20-8-10-22(28-4)17(3)16(20)2/h5-6,8,10,13,19,21H,7,9,11-12,14H2,1-4H3/t19-,21?/m0/s1 |
| InChIKey | ACLNKMWAYWFISC-ZQRQZVKFSA-N |
| XLogP | 3.68 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |