C29H34F3N5O2 — CID 76824807
[6-[2,3-dimethyl-4-[3-(triazol-2-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 76824807) has the molecular formula C29H34F3N5O2 and a molecular weight of 541.62 g/mol. Its IUPAC name is [6-[2,3-dimethyl-4-[3-(triazol-2-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [6-[2,3-dimethyl-4-[3-(triazol-2-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 76824807 |
| Molecular Formula | C29H34F3N5O2 |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | [6-[2,3-dimethyl-4-[3-(triazol-2-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1c(OCCCn2nccn2)ccc(C2CCCC3CN(C(=O)c4ccc(C(F)(F)F)cc4)CCN32)c1C |
| InChI | InChI=1S/C29H34F3N5O2/c1-20-21(2)27(39-18-4-15-37-33-13-14-34-37)12-11-25(20)26-6-3-5-24-19-35(16-17-36(24)26)28(38)22-7-9-23(10-8-22)29(30,31)32/h7-14,24,26H,3-6,15-19H2,1-2H3 |
| InChIKey | YZRSVRHEJNJSQC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|