C23H29ClN2O3S — CID 143169453
(5-chlorothiophen-2-yl)-[(6R)-6-[4-(2-hydroxyethoxy)-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]methanone (PubChem CID 143169453) has the molecular formula C23H29ClN2O3S and a molecular weight of 449.02 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-[(6R)-6-[4-(2-hydroxyethoxy)-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]methanone.
| Compound Name | (5-chlorothiophen-2-yl)-[(6R)-6-[4-(2-hydroxyethoxy)-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 143169453 |
| Molecular Formula | C23H29ClN2O3S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (5-chlorothiophen-2-yl)-[(6R)-6-[4-(2-hydroxyethoxy)-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]methanone |
| SMILES | Cc1c(OCCO)ccc([C@H]2CCCC3CN(C(=O)c4ccc(Cl)s4)CCN32)c1C |
| InChI | InChI=1S/C23H29ClN2O3S/c1-15-16(2)20(29-13-12-27)7-6-18(15)19-5-3-4-17-14-25(10-11-26(17)19)23(28)21-8-9-22(24)30-21/h6-9,17,19,27H,3-5,10-14H2,1-2H3/t17?,19-/m1/s1 |
| InChIKey | XKOWTBFTCWQTIJ-WHCXFUJUSA-N |
| XLogP | 4.44 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |