C22H34N2O4 — CID 20512601
1-heptyl-2,3-dinitro-4-(4-propylcyclohexyl)benzene (PubChem CID 20512601) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is 1-heptyl-2,3-dinitro-4-(4-propylcyclohexyl)benzene.
| Compound Name | 1-heptyl-2,3-dinitro-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 20512601 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 1-heptyl-2,3-dinitro-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCCCCCc1ccc(C2CCC(CCC)CC2)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H34N2O4/c1-3-5-6-7-8-10-19-15-16-20(22(24(27)28)21(19)23(25)26)18-13-11-17(9-4-2)12-14-18/h15-18H,3-14H2,1-2H3 |
| InChIKey | PPRZJIZYHULMSJ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|