About (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate
(pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate (PubChem CID 20513702) has the molecular formula C20H22INO4
and a molecular weight of 467.30 g/mol. Its IUPAC name is (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate.
Molecular Properties
| Compound Name | (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate |
| PubChem CID | 20513702 |
| Molecular Formula | C20H22INO4 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate |
| SMILES | CCC(CC)=NOC(=O)C(C)Oc1ccc(Oc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C20H22INO4/c1-4-16(5-2)22-26-20(23)14(3)24-17-10-12-19(13-11-17)25-18-8-6-15(21)7-9-18/h6-14H,4-5H2,1-3H3 |
| InChIKey | YPDIXSPDHASLQC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate?
The IUPAC name of (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate (CID 20513702) is (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate.
What is the SMILES notation for (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate?
The canonical SMILES for (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate is CCC(CC)=NOC(=O)C(C)Oc1ccc(Oc2ccc(I)cc2)cc1.
What is the InChIKey of (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate?
The InChIKey is YPDIXSPDHASLQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22INO4/c1-4-16(5-2)22-26-20(23)14(3)24-17-10-12-19(13-11-17)25-18-8-6-15(21)7-9-18/h6-14H,4-5H2,1-3H3.
What are the key properties of (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate?
(pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate has a molecular weight of 467.30 g/mol, XLogP of 5.57, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (pentan-3-ylideneamino) 2-[4-(4-iodophenoxy)phenoxy]propanoate is sourced from PubChem (CID 20513702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).