C17H14FN3O3 — CID 20515351
ethyl 14-fluoro-12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(13),3,5,8,14,16-hexaene-5-carboxylate (PubChem CID 20515351) has the molecular formula C17H14FN3O3 and a molecular weight of 327.32 g/mol. Its IUPAC name is ethyl 14-fluoro-12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(13),3,5,8,14,16-hexaene-5-carboxylate.
| Compound Name | ethyl 14-fluoro-12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(13),3,5,8,14,16-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 20515351 |
| Molecular Formula | C17H14FN3O3 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | ethyl 14-fluoro-12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(13),3,5,8,14,16-hexaene-5-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1C1C=CCN1C(=O)c1c(F)cccc1-2 |
| InChI | InChI=1S/C17H14FN3O3/c1-2-24-17(23)14-15-12-7-4-8-20(12)16(22)13-10(18)5-3-6-11(13)21(15)9-19-14/h3-7,9,12H,2,8H2,1H3 |
| InChIKey | LAUWELUAIUOYTI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|