C18H36O3Si2 — CID 20515531
4-trimethylsilyloxy-2-(7-trimethylsilyloxyheptyl)cyclopent-2-en-1-one (PubChem CID 20515531) has the molecular formula C18H36O3Si2 and a molecular weight of 356.66 g/mol. Its IUPAC name is 4-trimethylsilyloxy-2-(7-trimethylsilyloxyheptyl)cyclopent-2-en-1-one.
| Compound Name | 4-trimethylsilyloxy-2-(7-trimethylsilyloxyheptyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 20515531 |
| Molecular Formula | C18H36O3Si2 |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 4-trimethylsilyloxy-2-(7-trimethylsilyloxyheptyl)cyclopent-2-en-1-one |
| SMILES | C[Si](C)(C)OCCCCCCCC1=CC(O[Si](C)(C)C)CC1=O |
| InChI | InChI=1S/C18H36O3Si2/c1-22(2,3)20-13-11-9-7-8-10-12-16-14-17(15-18(16)19)21-23(4,5)6/h14,17H,7-13,15H2,1-6H3 |
| InChIKey | SHXRLOCGHSFLIX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|