C24H18N2O — CID 20515573
4-[2,3-bis[(E)-2-phenylethenyl]phenyl]oxadiazole (PubChem CID 20515573) has the molecular formula C24H18N2O and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[2,3-bis[(E)-2-phenylethenyl]phenyl]oxadiazole.
| Compound Name | 4-[2,3-bis[(E)-2-phenylethenyl]phenyl]oxadiazole |
|---|---|
| PubChem CID | 20515573 |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-[2,3-bis[(E)-2-phenylethenyl]phenyl]oxadiazole |
| SMILES | C(=C/c1cccc(-c2conn2)c1/C=C/c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C24H18N2O/c1-3-8-19(9-4-1)14-16-21-12-7-13-23(24-18-27-26-25-24)22(21)17-15-20-10-5-2-6-11-20/h1-18H/b16-14+,17-15+ |
| InChIKey | RVMFJNJWUXKKFH-YXLFCKQPSA-N |
| XLogP | 6.08 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|