C18H17FN4O2 — CID 20516904
N-[2-amino-4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-2-fluorobenzamide (PubChem CID 20516904) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is N-[2-amino-4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-2-fluorobenzamide.
| Compound Name | N-[2-amino-4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 20516904 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-[2-amino-4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-2-fluorobenzamide |
| SMILES | CC1CC(=O)NN=C1c1ccc(NC(=O)c2ccccc2F)c(N)c1 |
| InChI | InChI=1S/C18H17FN4O2/c1-10-8-16(24)22-23-17(10)11-6-7-15(14(20)9-11)21-18(25)12-4-2-3-5-13(12)19/h2-7,9-10H,8,20H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | UWSVBBXOFXRJHE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|