C13H13N3O — CID 20523282
3,5-dimethyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one (PubChem CID 20523282) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 3,5-dimethyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one.
| Compound Name | 3,5-dimethyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 20523282 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3,5-dimethyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one |
| SMILES | Cc1ncn2c1CN(C)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C13H13N3O/c1-9-12-7-15(2)13(17)10-5-3-4-6-11(10)16(12)8-14-9/h3-6,8H,7H2,1-2H3 |
| InChIKey | SRSPKIYYVGSPJK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |