C11H9N3 — CID 20524940
4H-imidazo[1,5-a][1,4]benzodiazepine (PubChem CID 20524940) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4H-imidazo[1,5-a][1,4]benzodiazepine.
| Compound Name | 4H-imidazo[1,5-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 20524940 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4H-imidazo[1,5-a][1,4]benzodiazepine |
| SMILES | C1=NCc2cncn2-c2ccccc21 |
| InChI | InChI=1S/C11H9N3/c1-2-4-11-9(3-1)5-12-6-10-7-13-8-14(10)11/h1-5,7-8H,6H2 |
| InChIKey | ACYRKKJVMXYGCK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |