About 4H-imidazo[1,5-a][1,4]benzodiazepine
4H-imidazo[1,5-a][1,4]benzodiazepine (PubChem CID 20524940) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 4H-imidazo[1,5-a][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 4H-imidazo[1,5-a][1,4]benzodiazepine |
| PubChem CID | 20524940 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4H-imidazo[1,5-a][1,4]benzodiazepine |
| SMILES | C1=NCc2cncn2-c2ccccc21 |
| InChI | InChI=1S/C11H9N3/c1-2-4-11-9(3-1)5-12-6-10-7-13-8-14(10)11/h1-5,7-8H,6H2 |
| InChIKey | ACYRKKJVMXYGCK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-imidazo[1,5-a][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-imidazo[1,5-a][1,4]benzodiazepine?
The IUPAC name of 4H-imidazo[1,5-a][1,4]benzodiazepine (CID 20524940) is 4H-imidazo[1,5-a][1,4]benzodiazepine.
What is the SMILES notation for 4H-imidazo[1,5-a][1,4]benzodiazepine?
The canonical SMILES for 4H-imidazo[1,5-a][1,4]benzodiazepine is C1=NCc2cncn2-c2ccccc21.
What is the InChIKey of 4H-imidazo[1,5-a][1,4]benzodiazepine?
The InChIKey is ACYRKKJVMXYGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3/c1-2-4-11-9(3-1)5-12-6-10-7-13-8-14(10)11/h1-5,7-8H,6H2.
What are the key properties of 4H-imidazo[1,5-a][1,4]benzodiazepine?
4H-imidazo[1,5-a][1,4]benzodiazepine has a molecular weight of 183.21 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-imidazo[1,5-a][1,4]benzodiazepine is sourced from PubChem (CID 20524940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).