C20H29N3O4 — CID 20527546
1-(2,3-diamino-4-methylphenoxy)-3-[2-(2-methoxyphenoxy)propylamino]propan-2-ol (PubChem CID 20527546) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-(2,3-diamino-4-methylphenoxy)-3-[2-(2-methoxyphenoxy)propylamino]propan-2-ol.
| Compound Name | 1-(2,3-diamino-4-methylphenoxy)-3-[2-(2-methoxyphenoxy)propylamino]propan-2-ol |
|---|---|
| PubChem CID | 20527546 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-(2,3-diamino-4-methylphenoxy)-3-[2-(2-methoxyphenoxy)propylamino]propan-2-ol |
| SMILES | COc1ccccc1OC(C)CNCC(O)COc1ccc(C)c(N)c1N |
| InChI | InChI=1S/C20H29N3O4/c1-13-8-9-18(20(22)19(13)21)26-12-15(24)11-23-10-14(2)27-17-7-5-4-6-16(17)25-3/h4-9,14-15,23-24H,10-12,21-22H2,1-3H3 |
| InChIKey | DCLUIWRKKJWCKZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|