About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride (PubChem CID 20529048) has the molecular formula C11H13ClF3N3
and a molecular weight of 279.69 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride |
| PubChem CID | 20529048 |
| Molecular Formula | C11H13ClF3N3 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc(NCC2=NCCN2)c1 |
| InChI | InChI=1S/C11H12F3N3.ClH/c12-11(13,14)8-2-1-3-9(6-8)17-7-10-15-4-5-16-10;/h1-3,6,17H,4-5,7H2,(H,15,16);1H |
| InChIKey | NNFVVWGXKLEUTC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride (CID 20529048) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride is Cl.FC(F)(F)c1cccc(NCC2=NCCN2)c1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride?
The InChIKey is NNFVVWGXKLEUTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3N3.ClH/c12-11(13,14)8-2-1-3-9(6-8)17-7-10-15-4-5-16-10;/h1-3,6,17H,4-5,7H2,(H,15,16);1H.
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride has a molecular weight of 279.69 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-(trifluoromethyl)aniline;hydrochloride is sourced from PubChem (CID 20529048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).