About hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium
hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium (PubChem CID 20529308) has the molecular formula C10H12AsF6N3O
and a molecular weight of 379.14 g/mol. Its IUPAC name is hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium.
Molecular Properties
| Compound Name | hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium |
| PubChem CID | 20529308 |
| Molecular Formula | C10H12AsF6N3O |
| Molecular Weight | 379.14 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium |
| SMILES | F[As-](F)(F)(F)(F)F.N#[N+]c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C10H12N3O.AsF6/c11-12-9-1-3-10(4-2-9)13-5-7-14-8-6-13;2-1(3,4,5,6)7/h1-4H,5-8H2;/q+1;-1 |
| InChIKey | FRNAYZQPLOUNIG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.14 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium?
The IUPAC name of hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium (CID 20529308) is hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium.
What is the SMILES notation for hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium?
The canonical SMILES for hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium is F[As-](F)(F)(F)(F)F.N#[N+]c1ccc(N2CCOCC2)cc1.
What is the InChIKey of hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium?
The InChIKey is FRNAYZQPLOUNIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N3O.AsF6/c11-12-9-1-3-10(4-2-9)13-5-7-14-8-6-13;2-1(3,4,5,6)7/h1-4H,5-8H2;/q+1;-1.
What are the key properties of hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium?
hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium has a molecular weight of 379.14 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroarsenic(1-);4-morpholin-4-ylbenzenediazonium is sourced from PubChem (CID 20529308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).