C9H9N3OS — CID 20532140
2-isothiocyanato-4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 20532140) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-isothiocyanato-4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
| Compound Name | 2-isothiocyanato-4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
|---|---|
| PubChem CID | 20532140 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-isothiocyanato-4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | COc1nc(N=C=S)nc2c1CCC2 |
| InChI | InChI=1S/C9H9N3OS/c1-13-8-6-3-2-4-7(6)11-9(12-8)10-5-14/h2-4H2,1H3 |
| InChIKey | NBTNPAHFOWNOEW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|