C21H28 — CID 20538383
1-(4-ethylcyclohexen-1-yl)-4-(4-methylcyclohexen-1-yl)benzene (PubChem CID 20538383) has the molecular formula C21H28 and a molecular weight of 280.45 g/mol. Its IUPAC name is 1-(4-ethylcyclohexen-1-yl)-4-(4-methylcyclohexen-1-yl)benzene.
| Compound Name | 1-(4-ethylcyclohexen-1-yl)-4-(4-methylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 20538383 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-(4-ethylcyclohexen-1-yl)-4-(4-methylcyclohexen-1-yl)benzene |
| SMILES | CCC1CC=C(c2ccc(C3=CCC(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C21H28/c1-3-17-6-10-19(11-7-17)21-14-12-20(13-15-21)18-8-4-16(2)5-9-18/h8,10,12-17H,3-7,9,11H2,1-2H3 |
| InChIKey | ZULWRROHRSORBJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |