C18H12ClN3O2S — CID 2053956
N-[(3-chlorophenyl)methyl]-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 2053956) has the molecular formula C18H12ClN3O2S and a molecular weight of 369.83 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 2053956 |
| Molecular Formula | C18H12ClN3O2S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1cc2c(=O)n3ccccc3nc2s1 |
| InChI | InChI=1S/C18H12ClN3O2S/c19-12-5-3-4-11(8-12)10-20-16(23)14-9-13-17(25-14)21-15-6-1-2-7-22(15)18(13)24/h1-9H,10H2,(H,20,23) |
| InChIKey | DDCZJDNKMSOQSZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |