C17H10FN3O2S — CID 866593
N-(3-fluorophenyl)-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 866593) has the molecular formula C17H10FN3O2S and a molecular weight of 339.35 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 866593 |
| Molecular Formula | C17H10FN3O2S |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-(3-fluorophenyl)-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cc2c(=O)n3ccccc3nc2s1 |
| InChI | InChI=1S/C17H10FN3O2S/c18-10-4-3-5-11(8-10)19-15(22)13-9-12-16(24-13)20-14-6-1-2-7-21(14)17(12)23/h1-9H,(H,19,22) |
| InChIKey | UHDHSSSAIHWYLJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |