About 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium
2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium (PubChem CID 20539754) has the molecular formula C8H9O7Ti
and a molecular weight of 265.02 g/mol. Its IUPAC name is 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium.
Molecular Properties
| Compound Name | 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium |
| PubChem CID | 20539754 |
| Molecular Formula | C8H9O7Ti |
| Molecular Weight | 265.02 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium |
| SMILES | C=CC(=O)C(O)(C(=O)O)C(=O)C=C.O=[Ti]O |
| InChI | InChI=1S/C8H8O5.H2O.O.Ti/c1-3-5(9)8(13,7(11)12)6(10)4-2;;;/h3-4,13H,1-2H2,(H,11,12);1H2;;/q;;;+1/p-1 |
| InChIKey | WBWMOWHHBJOXBJ-UHFFFAOYSA-M |
| XLogP | -1.37 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.02 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium?
The IUPAC name of 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium (CID 20539754) is 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium.
What is the SMILES notation for 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium?
The canonical SMILES for 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium is C=CC(=O)C(O)(C(=O)O)C(=O)C=C.O=[Ti]O.
What is the InChIKey of 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium?
The InChIKey is WBWMOWHHBJOXBJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O5.H2O.O.Ti/c1-3-5(9)8(13,7(11)12)6(10)4-2;;;/h3-4,13H,1-2H2,(H,11,12);1H2;;/q;;;+1/p-1.
What are the key properties of 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium?
2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium has a molecular weight of 265.02 g/mol, XLogP of -1.37, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-oxo-2-prop-2-enoylpent-4-enoic acid;hydroxy(oxo)titanium is sourced from PubChem (CID 20539754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).