About 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone
1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone (PubChem CID 20539777) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone |
| PubChem CID | 20539777 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone |
| SMILES | CC(=O)C1(O)C=CC(O)(C(C)=O)C=C1 |
| InChI | InChI=1S/C10H12O4/c1-7(11)9(13)3-5-10(14,6-4-9)8(2)12/h3-6,13-14H,1-2H3 |
| InChIKey | DTZZNINXSVAPLV-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone?
The IUPAC name of 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone (CID 20539777) is 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone.
What is the SMILES notation for 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone?
The canonical SMILES for 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone is CC(=O)C1(O)C=CC(O)(C(C)=O)C=C1.
What is the InChIKey of 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone?
The InChIKey is DTZZNINXSVAPLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-7(11)9(13)3-5-10(14,6-4-9)8(2)12/h3-6,13-14H,1-2H3.
What are the key properties of 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone?
1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone has a molecular weight of 196.20 g/mol, XLogP of -0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone is sourced from PubChem (CID 20539777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).