C10H12O4 — CID 20539777
1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone (PubChem CID 20539777) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone.
| Compound Name | 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 20539777 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-(4-acetyl-1,4-dihydroxycyclohexa-2,5-dien-1-yl)ethanone |
| SMILES | CC(=O)C1(O)C=CC(O)(C(C)=O)C=C1 |
| InChI | InChI=1S/C10H12O4/c1-7(11)9(13)3-5-10(14,6-4-9)8(2)12/h3-6,13-14H,1-2H3 |
| InChIKey | DTZZNINXSVAPLV-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|