C22H18Cl2O8 — CID 20539881
[2-acetyloxy-4-[2,2-dichloro-1-(3,4-diacetyloxyphenyl)ethenyl]phenyl] acetate (PubChem CID 20539881) has the molecular formula C22H18Cl2O8 and a molecular weight of 481.28 g/mol. Its IUPAC name is [2-acetyloxy-4-[2,2-dichloro-1-(3,4-diacetyloxyphenyl)ethenyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[2,2-dichloro-1-(3,4-diacetyloxyphenyl)ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 20539881 |
| Molecular Formula | C22H18Cl2O8 |
| Molecular Weight | 481.28 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | [2-acetyloxy-4-[2,2-dichloro-1-(3,4-diacetyloxyphenyl)ethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=C(Cl)Cl)c2ccc(OC(C)=O)c(OC(C)=O)c2)cc1OC(C)=O |
| InChI | InChI=1S/C22H18Cl2O8/c1-11(25)29-17-7-5-15(9-19(17)31-13(3)27)21(22(23)24)16-6-8-18(30-12(2)26)20(10-16)32-14(4)28/h5-10H,1-4H3 |
| InChIKey | CGZJQBFPVWBTPM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|