C15H20N2O5 — CID 134102316
[2-acetyloxy-4-[(tert-butylamino)carbamoyl]phenyl] acetate (PubChem CID 134102316) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [2-acetyloxy-4-[(tert-butylamino)carbamoyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[(tert-butylamino)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 134102316 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [2-acetyloxy-4-[(tert-butylamino)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)NNC(C)(C)C)cc1OC(C)=O |
| InChI | InChI=1S/C15H20N2O5/c1-9(18)21-12-7-6-11(8-13(12)22-10(2)19)14(20)16-17-15(3,4)5/h6-8,17H,1-5H3,(H,16,20) |
| InChIKey | GVSFXTWXQMJRJE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|