C10H13N3O2 — CID 20541680
1-(3-aminopropyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 20541680) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-(3-aminopropyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 1-(3-aminopropyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 20541680 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-(3-aminopropyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | Cc1cc(=O)n(CCCN)c(O)c1C#N |
| InChI | InChI=1S/C10H13N3O2/c1-7-5-9(14)13(4-2-3-11)10(15)8(7)6-12/h5,15H,2-4,11H2,1H3 |
| InChIKey | VYTZXZYNDFYYPC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |