About 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide
4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide (PubChem CID 20542471) has the molecular formula C4H5Br2NOS
and a molecular weight of 274.97 g/mol. Its IUPAC name is 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide.
Molecular Properties
| Compound Name | 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide |
| PubChem CID | 20542471 |
| Molecular Formula | C4H5Br2NOS |
| Molecular Weight | 274.97 g/mol |
| Exact Mass | 272.85 |
| IUPAC Name | 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide |
| SMILES | Br.Cn1scc(Br)c1=O |
| InChI | InChI=1S/C4H4BrNOS.BrH/c1-6-4(7)3(5)2-8-6;/h2H,1H3;1H |
| InChIKey | KJHNFJZWEDNDIJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.97 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide?
The IUPAC name of 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide (CID 20542471) is 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide.
What is the SMILES notation for 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide?
The canonical SMILES for 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide is Br.Cn1scc(Br)c1=O.
What is the InChIKey of 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide?
The InChIKey is KJHNFJZWEDNDIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrNOS.BrH/c1-6-4(7)3(5)2-8-6;/h2H,1H3;1H.
What are the key properties of 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide?
4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide has a molecular weight of 274.97 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methyl-1,2-thiazol-3-one;hydrobromide is sourced from PubChem (CID 20542471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).