C22H18N2O3 — CID 2054310
2,5-dioxo-N,1-diphenyl-7,8-dihydro-6H-quinoline-3-carboxamide (PubChem CID 2054310) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2,5-dioxo-N,1-diphenyl-7,8-dihydro-6H-quinoline-3-carboxamide.
| Compound Name | 2,5-dioxo-N,1-diphenyl-7,8-dihydro-6H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 2054310 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2,5-dioxo-N,1-diphenyl-7,8-dihydro-6H-quinoline-3-carboxamide |
| SMILES | O=C1CCCc2c1cc(C(=O)Nc1ccccc1)c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C22H18N2O3/c25-20-13-7-12-19-17(20)14-18(21(26)23-15-8-3-1-4-9-15)22(27)24(19)16-10-5-2-6-11-16/h1-6,8-11,14H,7,12-13H2,(H,23,26) |
| InChIKey | GRXRJLJSIURAFQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |