C20H18N2O4S — CID 1284511
2,5-dioxo-N-[(3S)-2-oxothiolan-3-yl]-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide (PubChem CID 1284511) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is 2,5-dioxo-N-[(3S)-2-oxothiolan-3-yl]-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide.
| Compound Name | 2,5-dioxo-N-[(3S)-2-oxothiolan-3-yl]-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 1284511 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2,5-dioxo-N-[(3S)-2-oxothiolan-3-yl]-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide |
| SMILES | O=C1CCCc2c1cc(C(=O)N[C@H]1CCSC1=O)c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C20H18N2O4S/c23-17-8-4-7-16-13(17)11-14(18(24)21-15-9-10-27-20(15)26)19(25)22(16)12-5-2-1-3-6-12/h1-3,5-6,11,15H,4,7-10H2,(H,21,24)/t15-/m0/s1 |
| InChIKey | GTJCWZXNGJKVLA-HNNXBMFYSA-N |
| XLogP | 2.12 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|