C69H100O12 — CID 20544401
[3-[6-(3,5-diethyl-4-hydroxyphenyl)hexanoyloxy]-2,2-bis[6-(3,5-diethyl-4-hydroxyphenyl)hexanoyloxymethyl]propyl] 6-(3,5-diethyl-4-hydroxyphenyl)hexanoate (PubChem CID 20544401) has the molecular formula C69H100O12 and a molecular weight of 1121.55 g/mol. Its IUPAC name is [3-[6-(3,5-diethyl-4-hydroxyphenyl)hexanoyloxy]-2,2-bis[6-(3,5-diethyl-4-hydroxyphenyl)hexanoyloxymethyl]propyl] 6-(3,5-diethyl-4-hydroxyphenyl)hexanoate.
| Compound Name | [3-[6-(3,5-diethyl-4-hydroxyphenyl)hexanoyloxy]-2,2-bis[6-(3,5-diethyl-4-hydroxyphenyl)hexanoyloxymethyl]propyl] 6-(3,5-diethyl-4-hydroxyphenyl)hexanoate |
|---|---|
| PubChem CID | 20544401 |
| Molecular Formula | C69H100O12 |
| Molecular Weight | 1121.55 g/mol |
| Exact Mass | 1120.72 |
| IUPAC Name | [3-[6-(3,5-diethyl-4-hydroxyphenyl)hexanoyloxy]-2,2-bis[6-(3,5-diethyl-4-hydroxyphenyl)hexanoyloxymethyl]propyl] 6-(3,5-diethyl-4-hydroxyphenyl)hexanoate |
| SMILES | CCc1cc(CCCCCC(=O)OCC(COC(=O)CCCCCc2cc(CC)c(O)c(CC)c2)(COC(=O)CCCCCc2cc(CC)c(O)c(CC)c2)COC(=O)CCCCCc2cc(CC)c(O)c(CC)c2)cc(CC)c1O |
| InChI | InChI=1S/C69H100O12/c1-9-53-37-49(38-54(10-2)65(53)74)29-21-17-25-33-61(70)78-45-69(46-79-62(71)34-26-18-22-30-50-39-55(11-3)66(75)56(12-4)40-50,47-80-63(72)35-27-19-23-31-51-41-57(13-5)67(76)58(14-6)42-51)48-81-64(73)36-28-20-24-32-52-43-59(15-7)68(77)60(16-8)44-52/h37-44,74-77H,9-36,45-48H2,1-8H3 |
| InChIKey | BZEGVKHVPQAKPV-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.55 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|