C8H21NO8S2 — CID 20545749
2-(2,3-dihydroxypropylamino)ethanesulfonic acid;propane-1-sulfonic acid (PubChem CID 20545749) has the molecular formula C8H21NO8S2 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)ethanesulfonic acid;propane-1-sulfonic acid.
| Compound Name | 2-(2,3-dihydroxypropylamino)ethanesulfonic acid;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 20545749 |
| Molecular Formula | C8H21NO8S2 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)ethanesulfonic acid;propane-1-sulfonic acid |
| SMILES | CCCS(=O)(=O)O.O=S(=O)(O)CCNCC(O)CO |
| InChI | InChI=1S/C5H13NO5S.C3H8O3S/c7-4-5(8)3-6-1-2-12(9,10)11;1-2-3-7(4,5)6/h5-8H,1-4H2,(H,9,10,11);2-3H2,1H3,(H,4,5,6) |
| InChIKey | RVZFHCMQWKQZIE-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|