C6H15NO7S2 — CID 88932687
2-hydroxy-3-(3-sulfopropylamino)propane-1-sulfonic acid (PubChem CID 88932687) has the molecular formula C6H15NO7S2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-hydroxy-3-(3-sulfopropylamino)propane-1-sulfonic acid.
| Compound Name | 2-hydroxy-3-(3-sulfopropylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88932687 |
| Molecular Formula | C6H15NO7S2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-hydroxy-3-(3-sulfopropylamino)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNCC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C6H15NO7S2/c8-6(5-16(12,13)14)4-7-2-1-3-15(9,10)11/h6-8H,1-5H2,(H,9,10,11)(H,12,13,14) |
| InChIKey | MLDDWLXQEWWYJC-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|