C7H17NO8S2 — CID 166824674
3-[2-hydroxy-3-(sulfomethylamino)propoxy]propane-1-sulfonic acid (PubChem CID 166824674) has the molecular formula C7H17NO8S2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(sulfomethylamino)propoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-hydroxy-3-(sulfomethylamino)propoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 166824674 |
| Molecular Formula | C7H17NO8S2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 3-[2-hydroxy-3-(sulfomethylamino)propoxy]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCOCC(O)CNCS(=O)(=O)O |
| InChI | InChI=1S/C7H17NO8S2/c9-7(4-8-6-18(13,14)15)5-16-2-1-3-17(10,11)12/h7-9H,1-6H2,(H,10,11,12)(H,13,14,15) |
| InChIKey | TZFWCORCMWKJQD-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|