C21H41N3O12S — CID 21026797
2-[carboxymethyl-[1-[2-[[2-hydroxy-3-[4-(2-hydroxybutoxy)butoxy]propyl]amino]ethylamino]-1-oxo-4-sulfobutan-2-yl]amino]acetic acid (PubChem CID 21026797) has the molecular formula C21H41N3O12S and a molecular weight of 559.64 g/mol. Its IUPAC name is 2-[carboxymethyl-[1-[2-[[2-hydroxy-3-[4-(2-hydroxybutoxy)butoxy]propyl]amino]ethylamino]-1-oxo-4-sulfobutan-2-yl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[1-[2-[[2-hydroxy-3-[4-(2-hydroxybutoxy)butoxy]propyl]amino]ethylamino]-1-oxo-4-sulfobutan-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 21026797 |
| Molecular Formula | C21H41N3O12S |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 2-[carboxymethyl-[1-[2-[[2-hydroxy-3-[4-(2-hydroxybutoxy)butoxy]propyl]amino]ethylamino]-1-oxo-4-sulfobutan-2-yl]amino]acetic acid |
| SMILES | CCC(O)COCCCCOCC(O)CNCCNC(=O)C(CCS(=O)(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C21H41N3O12S/c1-2-16(25)14-35-8-3-4-9-36-15-17(26)11-22-6-7-23-21(31)18(5-10-37(32,33)34)24(12-19(27)28)13-20(29)30/h16-18,22,25-26H,2-15H2,1H3,(H,23,31)(H,27,28)(H,29,30)(H,32,33,34) |
| InChIKey | UQDCDQBDTHABLB-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 232.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|