C11H22N2O7 — CID 139456344
2-[2-[[3-[2-(carboxymethoxy)ethoxy]-2-hydroxypropyl]amino]ethylamino]acetic acid (PubChem CID 139456344) has the molecular formula C11H22N2O7 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-[2-[[3-[2-(carboxymethoxy)ethoxy]-2-hydroxypropyl]amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[[3-[2-(carboxymethoxy)ethoxy]-2-hydroxypropyl]amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 139456344 |
| Molecular Formula | C11H22N2O7 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[2-[[3-[2-(carboxymethoxy)ethoxy]-2-hydroxypropyl]amino]ethylamino]acetic acid |
| SMILES | O=C(O)CNCCNCC(O)COCCOCC(=O)O |
| InChI | InChI=1S/C11H22N2O7/c14-9(5-12-1-2-13-6-10(15)16)7-19-3-4-20-8-11(17)18/h9,12-14H,1-8H2,(H,15,16)(H,17,18) |
| InChIKey | JUXQDINLXMFNOJ-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|