C14H28N2O10 — CID 53400535
acetic acid;2-[2-[2-[2-(carboxymethylamino)ethoxy]ethoxy]ethylamino]acetic acid (PubChem CID 53400535) has the molecular formula C14H28N2O10 and a molecular weight of 384.38 g/mol. Its IUPAC name is acetic acid;2-[2-[2-[2-(carboxymethylamino)ethoxy]ethoxy]ethylamino]acetic acid.
| Compound Name | acetic acid;2-[2-[2-[2-(carboxymethylamino)ethoxy]ethoxy]ethylamino]acetic acid |
|---|---|
| PubChem CID | 53400535 |
| Molecular Formula | C14H28N2O10 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | acetic acid;2-[2-[2-[2-(carboxymethylamino)ethoxy]ethoxy]ethylamino]acetic acid |
| SMILES | CC(=O)O.CC(=O)O.O=C(O)CNCCOCCOCCNCC(=O)O |
| InChI | InChI=1S/C10H20N2O6.2C2H4O2/c13-9(14)7-11-1-3-17-5-6-18-4-2-12-8-10(15)16;2*1-2(3)4/h11-12H,1-8H2,(H,13,14)(H,15,16);2*1H3,(H,3,4) |
| InChIKey | BRNDTMIAJDTZSE-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 191.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|