C13H19Cl2NO — CID 2054660
N-[3-(2,3-dichlorophenoxy)propyl]-2-methylpropan-2-amine (PubChem CID 2054660) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is N-[3-(2,3-dichlorophenoxy)propyl]-2-methylpropan-2-amine.
| Compound Name | N-[3-(2,3-dichlorophenoxy)propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 2054660 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-[3-(2,3-dichlorophenoxy)propyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H19Cl2NO/c1-13(2,3)16-8-5-9-17-11-7-4-6-10(14)12(11)15/h4,6-7,16H,5,8-9H2,1-3H3 |
| InChIKey | ZEYVAWOWJTVERR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|