C13H25NO — CID 20549202
N,1-diethyl-2-methylcycloheptane-1-carboxamide (PubChem CID 20549202) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is N,1-diethyl-2-methylcycloheptane-1-carboxamide.
| Compound Name | N,1-diethyl-2-methylcycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 20549202 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N,1-diethyl-2-methylcycloheptane-1-carboxamide |
| SMILES | CCNC(=O)C1(CC)CCCCCC1C |
| InChI | InChI=1S/C13H25NO/c1-4-13(12(15)14-5-2)10-8-6-7-9-11(13)3/h11H,4-10H2,1-3H3,(H,14,15) |
| InChIKey | LLMQFJHTRJWXJJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |