C13H20O3 — CID 20549585
2-(2-methoxy-1-methylcyclohex-2-en-1-yl)pent-4-enoic acid (PubChem CID 20549585) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-(2-methoxy-1-methylcyclohex-2-en-1-yl)pent-4-enoic acid.
| Compound Name | 2-(2-methoxy-1-methylcyclohex-2-en-1-yl)pent-4-enoic acid |
|---|---|
| PubChem CID | 20549585 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-(2-methoxy-1-methylcyclohex-2-en-1-yl)pent-4-enoic acid |
| SMILES | C=CCC(C(=O)O)C1(C)CCCC=C1OC |
| InChI | InChI=1S/C13H20O3/c1-4-7-10(12(14)15)13(2)9-6-5-8-11(13)16-3/h4,8,10H,1,5-7,9H2,2-3H3,(H,14,15) |
| InChIKey | ZBIBOOYJCFLNEC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|