C20H24OSe — CID 11222107
(1Z)-1-(cyclohexen-1-yl)-1-methylselanyl-4-phenylhepta-1,6-dien-3-one (PubChem CID 11222107) has the molecular formula C20H24OSe and a molecular weight of 359.37 g/mol. Its IUPAC name is (1Z)-1-(cyclohexen-1-yl)-1-methylselanyl-4-phenylhepta-1,6-dien-3-one.
| Compound Name | (1Z)-1-(cyclohexen-1-yl)-1-methylselanyl-4-phenylhepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 11222107 |
| Molecular Formula | C20H24OSe |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (1Z)-1-(cyclohexen-1-yl)-1-methylselanyl-4-phenylhepta-1,6-dien-3-one |
| SMILES | C=CCC(C(=O)/C=C(\[Se]C)C1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H24OSe/c1-3-10-18(16-11-6-4-7-12-16)19(21)15-20(22-2)17-13-8-5-9-14-17/h3-4,6-7,11-13,15,18H,1,5,8-10,14H2,2H3/b20-15- |
| InChIKey | BXZPSAVSBHSKSK-HKWRFOASSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|