C13H17NSe — CID 11323079
N,N-dimethyl-2-phenylpent-4-eneselenoamide (PubChem CID 11323079) has the molecular formula C13H17NSe and a molecular weight of 266.25 g/mol. Its IUPAC name is N,N-dimethyl-2-phenylpent-4-eneselenoamide.
| Compound Name | N,N-dimethyl-2-phenylpent-4-eneselenoamide |
|---|---|
| PubChem CID | 11323079 |
| Molecular Formula | C13H17NSe |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N,N-dimethyl-2-phenylpent-4-eneselenoamide |
| SMILES | C=CCC(C(=[Se])N(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H17NSe/c1-4-8-12(13(15)14(2)3)11-9-6-5-7-10-11/h4-7,9-10,12H,1,8H2,2-3H3 |
| InChIKey | YDZHKOSHIYJDQJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|