C17H19ClN4O2 — CID 20549931
10-(2-chloropropanoyl)-3-methyl-1-propan-2-yl-5H-pyrazolo[5,4-c][1,5]benzodiazepin-4-one (PubChem CID 20549931) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 10-(2-chloropropanoyl)-3-methyl-1-propan-2-yl-5H-pyrazolo[5,4-c][1,5]benzodiazepin-4-one.
| Compound Name | 10-(2-chloropropanoyl)-3-methyl-1-propan-2-yl-5H-pyrazolo[5,4-c][1,5]benzodiazepin-4-one |
|---|---|
| PubChem CID | 20549931 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 10-(2-chloropropanoyl)-3-methyl-1-propan-2-yl-5H-pyrazolo[5,4-c][1,5]benzodiazepin-4-one |
| SMILES | CC(Cl)C(=O)N1c2ccccc2NC(=O)c2c1c(C(C)C)nn2C |
| InChI | InChI=1S/C17H19ClN4O2/c1-9(2)13-14-15(21(4)20-13)16(23)19-11-7-5-6-8-12(11)22(14)17(24)10(3)18/h5-10H,1-4H3,(H,19,23) |
| InChIKey | UTQMFEQIHLQIAV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|