About tris(1,12-diethoxydodecan-5-yl) phosphate
tris(1,12-diethoxydodecan-5-yl) phosphate (PubChem CID 20550498) has the molecular formula C48H99O10P
and a molecular weight of 867.28 g/mol. Its IUPAC name is tris(1,12-diethoxydodecan-5-yl) phosphate.
Molecular Properties
| Compound Name | tris(1,12-diethoxydodecan-5-yl) phosphate |
| PubChem CID | 20550498 |
| Molecular Formula | C48H99O10P |
| Molecular Weight | 867.28 g/mol |
| Exact Mass | 866.70 |
| IUPAC Name | tris(1,12-diethoxydodecan-5-yl) phosphate |
| SMILES | CCOCCCCCCCC(CCCCOCC)OP(=O)(OC(CCCCCCCOCC)CCCCOCC)OC(CCCCCCCOCC)CCCCOCC |
| InChI | InChI=1S/C48H99O10P/c1-7-50-40-28-19-13-16-22-34-46(37-25-31-43-53-10-4)56-59(49,57-47(38-26-32-44-54-11-5)35-23-17-14-20-29-41-51-8-2)58-48(39-27-33-45-55-12-6)36-24-18-15-21-30-42-52-9-3/h46-48H,7-45H2,1-6H3 |
| InChIKey | SITIFSBCWHCKPO-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 867.28 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(1,12-diethoxydodecan-5-yl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(1,12-diethoxydodecan-5-yl) phosphate?
The IUPAC name of tris(1,12-diethoxydodecan-5-yl) phosphate (CID 20550498) is tris(1,12-diethoxydodecan-5-yl) phosphate.
What is the SMILES notation for tris(1,12-diethoxydodecan-5-yl) phosphate?
The canonical SMILES for tris(1,12-diethoxydodecan-5-yl) phosphate is CCOCCCCCCCC(CCCCOCC)OP(=O)(OC(CCCCCCCOCC)CCCCOCC)OC(CCCCCCCOCC)CCCCOCC.
What is the InChIKey of tris(1,12-diethoxydodecan-5-yl) phosphate?
The InChIKey is SITIFSBCWHCKPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H99O10P/c1-7-50-40-28-19-13-16-22-34-46(37-25-31-43-53-10-4)56-59(49,57-47(38-26-32-44-54-11-5)35-23-17-14-20-29-41-51-8-2)58-48(39-27-33-45-55-12-6)36-24-18-15-21-30-42-52-9-3/h46-48H,7-45H2,1-6H3.
What are the key properties of tris(1,12-diethoxydodecan-5-yl) phosphate?
tris(1,12-diethoxydodecan-5-yl) phosphate has a molecular weight of 867.28 g/mol, XLogP of 14.00, 51 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for tris(1,12-diethoxydodecan-5-yl) phosphate is sourced from PubChem (CID 20550498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).