About 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate
1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate (PubChem CID 2055170) has the molecular formula C14H22N2O4S
and a molecular weight of 314.41 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate |
| PubChem CID | 2055170 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate |
| SMILES | CCC[C@@](CCC(=O)OC)(C(=O)OCC)c1csc(N)n1 |
| InChI | InChI=1S/C14H22N2O4S/c1-4-7-14(12(18)20-5-2,8-6-11(17)19-3)10-9-21-13(15)16-10/h9H,4-8H2,1-3H3,(H2,15,16)/t14-/m0/s1 |
| InChIKey | ZAUYDTNANLYZLL-AWEZNQCLSA-N |
| XLogP | 2.28 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate?
The IUPAC name of 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate (CID 2055170) is 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate.
What is the SMILES notation for 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate?
The canonical SMILES for 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate is CCC[C@@](CCC(=O)OC)(C(=O)OCC)c1csc(N)n1.
What is the InChIKey of 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate?
The InChIKey is ZAUYDTNANLYZLL-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H22N2O4S/c1-4-7-14(12(18)20-5-2,8-6-11(17)19-3)10-9-21-13(15)16-10/h9H,4-8H2,1-3H3,(H2,15,16)/t14-/m0/s1.
What are the key properties of 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate?
1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate has a molecular weight of 314.41 g/mol, XLogP of 2.28, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-methyl (2S)-2-(2-amino-1,3-thiazol-4-yl)-2-propylpentanedioate is sourced from PubChem (CID 2055170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).