C8H15NOS2 — CID 20554156
N,N-bis(ethylsulfanyl)-2-methylprop-2-enamide (PubChem CID 20554156) has the molecular formula C8H15NOS2 and a molecular weight of 205.35 g/mol. Its IUPAC name is N,N-bis(ethylsulfanyl)-2-methylprop-2-enamide.
| Compound Name | N,N-bis(ethylsulfanyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 20554156 |
| Molecular Formula | C8H15NOS2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | N,N-bis(ethylsulfanyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(SCC)SCC |
| InChI | InChI=1S/C8H15NOS2/c1-5-11-9(12-6-2)8(10)7(3)4/h3,5-6H2,1-2,4H3 |
| InChIKey | UPJATFWGEOJCHU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|