C13H15BrN2O3S2 — CID 2055633
2-methylsulfanylethyl (4S,5R)-4-(5-bromothiophen-2-yl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate (PubChem CID 2055633) has the molecular formula C13H15BrN2O3S2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 2-methylsulfanylethyl (4S,5R)-4-(5-bromothiophen-2-yl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate.
| Compound Name | 2-methylsulfanylethyl (4S,5R)-4-(5-bromothiophen-2-yl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2055633 |
| Molecular Formula | C13H15BrN2O3S2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 2-methylsulfanylethyl (4S,5R)-4-(5-bromothiophen-2-yl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=O)N[C@H](c2ccc(Br)s2)[C@H]1C(=O)OCCSC |
| InChI | InChI=1S/C13H15BrN2O3S2/c1-7-10(12(17)19-5-6-20-2)11(16-13(18)15-7)8-3-4-9(14)21-8/h3-4,10-11H,1,5-6H2,2H3,(H2,15,16,18)/t10-,11+/m0/s1 |
| InChIKey | DKZIKENHJBZFDI-WDEREUQCSA-N |
| XLogP | 2.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|