C18H26Cl2N2O — CID 20556403
3-chloro-N-[4-chloro-2-(dimethylamino)cycloheptyl]-N-phenylpropanamide (PubChem CID 20556403) has the molecular formula C18H26Cl2N2O and a molecular weight of 357.33 g/mol. Its IUPAC name is 3-chloro-N-[4-chloro-2-(dimethylamino)cycloheptyl]-N-phenylpropanamide.
| Compound Name | 3-chloro-N-[4-chloro-2-(dimethylamino)cycloheptyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 20556403 |
| Molecular Formula | C18H26Cl2N2O |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-chloro-N-[4-chloro-2-(dimethylamino)cycloheptyl]-N-phenylpropanamide |
| SMILES | CN(C)C1CC(Cl)CCCC1N(C(=O)CCCl)c1ccccc1 |
| InChI | InChI=1S/C18H26Cl2N2O/c1-21(2)17-13-14(20)7-6-10-16(17)22(18(23)11-12-19)15-8-4-3-5-9-15/h3-5,8-9,14,16-17H,6-7,10-13H2,1-2H3 |
| InChIKey | KHIHSEOICVEHQG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|