C16H22Cl2N2O — CID 22807401
3-chloro-N-[(1R,2R)-4-chloro-2-(dimethylamino)cyclopentyl]-N-phenylpropanamide (PubChem CID 22807401) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is 3-chloro-N-[(1R,2R)-4-chloro-2-(dimethylamino)cyclopentyl]-N-phenylpropanamide.
| Compound Name | 3-chloro-N-[(1R,2R)-4-chloro-2-(dimethylamino)cyclopentyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 22807401 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-chloro-N-[(1R,2R)-4-chloro-2-(dimethylamino)cyclopentyl]-N-phenylpropanamide |
| SMILES | CN(C)[C@@H]1CC(Cl)C[C@H]1N(C(=O)CCCl)c1ccccc1 |
| InChI | InChI=1S/C16H22Cl2N2O/c1-19(2)14-10-12(18)11-15(14)20(16(21)8-9-17)13-6-4-3-5-7-13/h3-7,12,14-15H,8-11H2,1-2H3/t12?,14-,15-/m1/s1 |
| InChIKey | QYGJEAIFPBOORT-JENMUQSASA-N |
| XLogP | 3.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|