C11H16ClN3O2 — CID 20560592
3-(5-tert-butyl-1,2-oxazol-3-yl)-4-chloro-1-methylimidazolidin-2-one (PubChem CID 20560592) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,2-oxazol-3-yl)-4-chloro-1-methylimidazolidin-2-one.
| Compound Name | 3-(5-tert-butyl-1,2-oxazol-3-yl)-4-chloro-1-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 20560592 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-(5-tert-butyl-1,2-oxazol-3-yl)-4-chloro-1-methylimidazolidin-2-one |
| SMILES | CN1CC(Cl)N(c2cc(C(C)(C)C)on2)C1=O |
| InChI | InChI=1S/C11H16ClN3O2/c1-11(2,3)7-5-9(13-17-7)15-8(12)6-14(4)10(15)16/h5,8H,6H2,1-4H3 |
| InChIKey | VBMPGIVCMVVMNF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|