C32H37F3N2O4 — CID 20561391
diethyl 1-[N-(2,2-dimethylpropyl)-C-phenylcarbonimidoyl]-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate (PubChem CID 20561391) has the molecular formula C32H37F3N2O4 and a molecular weight of 570.65 g/mol. Its IUPAC name is diethyl 1-[N-(2,2-dimethylpropyl)-C-phenylcarbonimidoyl]-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-[N-(2,2-dimethylpropyl)-C-phenylcarbonimidoyl]-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 20561391 |
| Molecular Formula | C32H37F3N2O4 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | diethyl 1-[N-(2,2-dimethylpropyl)-C-phenylcarbonimidoyl]-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(/C(=N/CC(C)(C)C)c2ccccc2)C(C)=C(C(=O)OCC)C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C32H37F3N2O4/c1-8-40-29(38)25-20(3)37(28(36-19-31(5,6)7)22-15-11-10-12-16-22)21(4)26(30(39)41-9-2)27(25)23-17-13-14-18-24(23)32(33,34)35/h10-18,27H,8-9,19H2,1-7H3/b36-28+ |
| InChIKey | JYBFCGBLYDCIJN-FDEZRRJOSA-N |
| XLogP | 7.27 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|