C34H36N2O6 — CID 20561406
diethyl 4-(2-methoxyphenyl)-1-[N-(2-methoxyphenyl)-C-phenylcarbonimidoyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 20561406) has the molecular formula C34H36N2O6 and a molecular weight of 568.67 g/mol. Its IUPAC name is diethyl 4-(2-methoxyphenyl)-1-[N-(2-methoxyphenyl)-C-phenylcarbonimidoyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(2-methoxyphenyl)-1-[N-(2-methoxyphenyl)-C-phenylcarbonimidoyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 20561406 |
| Molecular Formula | C34H36N2O6 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | diethyl 4-(2-methoxyphenyl)-1-[N-(2-methoxyphenyl)-C-phenylcarbonimidoyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(/C(=N/c2ccccc2OC)c2ccccc2)C(C)=C(C(=O)OCC)C1c1ccccc1OC |
| InChI | InChI=1S/C34H36N2O6/c1-7-41-33(37)29-22(3)36(32(24-16-10-9-11-17-24)35-26-19-13-15-21-28(26)40-6)23(4)30(34(38)42-8-2)31(29)25-18-12-14-20-27(25)39-5/h9-21,31H,7-8H2,1-6H3/b35-32+ |
| InChIKey | NFNVPFBDAKCGIC-LVYIWIAJSA-N |
| XLogP | 6.56 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|