C17H12ClN3O3 — CID 20562041
5-chloro-7-oxo-2-phenyl-8-prop-2-enylpyrido[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 20562041) has the molecular formula C17H12ClN3O3 and a molecular weight of 341.75 g/mol. Its IUPAC name is 5-chloro-7-oxo-2-phenyl-8-prop-2-enylpyrido[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 5-chloro-7-oxo-2-phenyl-8-prop-2-enylpyrido[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 20562041 |
| Molecular Formula | C17H12ClN3O3 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 5-chloro-7-oxo-2-phenyl-8-prop-2-enylpyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | C=CCn1c(=O)c(C(=O)O)c(Cl)c2cnc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C17H12ClN3O3/c1-2-8-21-15-11(13(18)12(16(21)22)17(23)24)9-19-14(20-15)10-6-4-3-5-7-10/h2-7,9H,1,8H2,(H,23,24) |
| InChIKey | WKPUJTHWFOPCEM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|