C17H19N3O3 — CID 20524649
7-methyl-2-oxo-1-prop-2-enyl-4-pyrrolidin-1-yl-1,8-naphthyridine-3-carboxylic acid (PubChem CID 20524649) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 7-methyl-2-oxo-1-prop-2-enyl-4-pyrrolidin-1-yl-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-methyl-2-oxo-1-prop-2-enyl-4-pyrrolidin-1-yl-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 20524649 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 7-methyl-2-oxo-1-prop-2-enyl-4-pyrrolidin-1-yl-1,8-naphthyridine-3-carboxylic acid |
| SMILES | C=CCn1c(=O)c(C(=O)O)c(N2CCCC2)c2ccc(C)nc21 |
| InChI | InChI=1S/C17H19N3O3/c1-3-8-20-15-12(7-6-11(2)18-15)14(19-9-4-5-10-19)13(16(20)21)17(22)23/h3,6-7H,1,4-5,8-10H2,2H3,(H,22,23) |
| InChIKey | YTLUPVVKUUEENN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|